What is the correct formula for ammonium sulfide?Group of answer choices(NH4)2SO4(NH4)2SNH3SNH4SO3

Give the formula of ammonium sulfate.(NH4)2SO3NH4SO4(NH4)3SO4(NH4)2SO4(NH4)2(SO4)2

Which one of the formulae below is the correct chemical formula for ammonium sulfate?Group of answer choices(a)   NH3SO4(b)   (NH3)2SO4(c)   NH4SO4(d)   NH4(SO4)2(e)   (NH4)2SO4

36. What is the formula of ammonium phosphate?1 point(NH4)3PO4NH4(PO4)3NH4PO4N3H12PO4

How many grams of nitrogen is approximately present in every 100 g of ammonium sulphate(NH4)2SO4?

What is the chemical formula of Anhydrous Mohr's salt?a.Fe(NH4)2(SO4)b.FeSO4c.FeSO4(NH4)2SO4d.FeSO4(NH4)2SO4.6H2O