Give the formula of ammonium sulfate.(NH4)2SO3NH4SO4(NH4)3SO4(NH4)2SO4(NH4)2(SO4)2

What is the correct formula for ammonium sulfide?Group of answer choices(NH4)2SO4(NH4)2SNH3SNH4SO3

Which one of the formulae below is the correct chemical formula for ammonium sulfate?Group of answer choices(a)   NH3SO4(b)   (NH3)2SO4(c)   NH4SO4(d)   NH4(SO4)2(e)   (NH4)2SO4

36. What is the formula of ammonium phosphate?1 point(NH4)3PO4NH4(PO4)3NH4PO4N3H12PO4

What is the chemical formula of Anhydrous Mohr's salt?a.Fe(NH4)2(SO4)b.FeSO4c.FeSO4(NH4)2SO4d.FeSO4(NH4)2SO4.6H2O

Provide the correct IUPAC name for the following compound[Ni(NH3)4(H2O)2]SO4