Which one of the formulae below is the correct chemical formula for ammonium sulfate?Group of answer choices(a) NH3SO4(b) (NH3)2SO4(c) NH4SO4(d) NH4(SO4)2(e) (NH4)2SO4
Question
Which one of the formulae below is the correct chemical formula for ammonium sulfate?Group of answer choices(a) NH3SO4(b) (NH3)2SO4(c) NH4SO4(d) NH4(SO4)2(e) (NH4)2SO4
Solution
The correct chemical formula for ammonium sulfate is (NH4)2SO4. So, the correct answer is (e) (NH4)2SO4.
Here's why:
Ammonium is a polyatomic ion with the formula NH4+. Sulfate is a polyatomic ion with the formula SO4^2-.
When these two ions combine to form a neutral compound, we need two NH4+ ions to balance out the 2- charge on the SO4^2- ion.
So, the correct formula is (NH4)2SO4.
Similar Questions
What is the correct formula for ammonium sulfide?Group of answer choices(NH4)2SO4(NH4)2SNH3SNH4SO3
Give the formula of ammonium sulfate.(NH4)2SO3NH4SO4(NH4)3SO4(NH4)2SO4(NH4)2(SO4)2
Which of the following compound/ions is amphoteric? Question 92Select one: a. SO2 b. NH3 c. H2SO4 d. None of the other choices is true e. HCO3-
36. What is the formula of ammonium phosphate?1 point(NH4)3PO4NH4(PO4)3NH4PO4N3H12PO4
What is the chemical formula of Anhydrous Mohr's salt?a.Fe(NH4)2(SO4)b.FeSO4c.FeSO4(NH4)2SO4d.FeSO4(NH4)2SO4.6H2O
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.