36. What is the formula of ammonium phosphate?1 point(NH4)3PO4NH4(PO4)3NH4PO4N3H12PO4

Give the formula of ammonium sulfate.(NH4)2SO3NH4SO4(NH4)3SO4(NH4)2SO4(NH4)2(SO4)2

What is the correct formula for ammonium sulfide?Group of answer choices(NH4)2SO4(NH4)2SNH3SNH4SO3

Ammonium phosphate NH43PO4 is an important ingredient in many solid fertilizers. It can be made by reacting aqueous phosphoric acid H3PO4 with liquid ammonia. Calculate the moles of ammonium phosphate produced by the reaction of 2.0mol of phosphoric acid. Be sure your answer has a unit symbol, if necessary, and round it to 2 significant digits.

___ (NH4)3PO4 + ___ Pb(NO3)4 --> ___ Pb3(PO4)4 +  ___ NH4NO3

Which one of the formulae below is the correct chemical formula for ammonium sulfate?Group of answer choices(a)   NH3SO4(b)   (NH3)2SO4(c)   NH4SO4(d)   NH4(SO4)2(e)   (NH4)2SO4