How many grams of nitrogen is approximately present in every 100 g of ammonium sulphate(NH4)2SO4?
Question
How many grams of nitrogen is approximately present in every 100 g of ammonium sulphate(NH4)2SO4?
Solution
To find out how many grams of nitrogen are present in 100g of ammonium sulphate (NH4)2SO4, we need to follow these steps:
-
First, we need to find the molar mass of ammonium sulphate. The molar mass of nitrogen (N) is approximately 14g/mol, hydrogen (H) is approximately 1g/mol, sulphur (S) is approximately 32g/mol, and oxygen (O) is approximately 16g/mol.
In ammonium sulphate, there are 2 nitrogen atoms, 8 hydrogen atoms, 1 sulphur atom, and 4 oxygen atoms.
So, the molar mass of ammonium sulphate is (214) + (81) + 32 + (4*16) = 132 g/mol.
-
Next, we need to find out how much nitrogen is there in one mole of ammonium sulphate. Since there are 2 nitrogen atoms in one molecule of ammonium sulphate, there are 2 moles of nitrogen in one mole of ammonium sulphate.
So, the mass of nitrogen in one mole of ammonium sulphate is 2*14 = 28g.
-
Now, we need to find out how much nitrogen is there in 100g of ammonium sulphate.
To do this, we set up a proportion: (28g nitrogen / 132g ammonium sulphate) = (x g nitrogen / 100g ammonium sulphate)
Solving for x gives us x = (28*100) / 132 = 21.21g
So, there are approximately 21.21g of nitrogen in every 100g of ammonium sulphate.
Similar Questions
A sample of ammonia weighs 4 g. What massof sulphur dioxide contains the same numberof molecules as are in 4 g of ammonia?
What is the mass of nitrogen in 43.7 g of ammonium carbonate, (NH4)2CO3?
What is the correct formula for ammonium sulfide?Group of answer choices(NH4)2SO4(NH4)2SNH3SNH4SO3
Ammonium chromate, (NH4)2CrO4NH42CrO4 , contains what percent nitrogen by mass? 36.8%36.8% 32.0%32.0% 9.21%9.21% 18.4%18.4% 11.9%11.9%
Give the formula of ammonium sulfate.(NH4)2SO3NH4SO4(NH4)3SO4(NH4)2SO4(NH4)2(SO4)2
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.