Which of the following is a secondary amine ?A Aniline B Toluidine C Hexamethylene diamine D Ethylmethyl amine
Question
Which of the following is a secondary amine ?A Aniline B Toluidine C Hexamethylene diamine D Ethylmethyl amine
Solution
A secondary amine is an amine that has two organic substituents (alkyl, aryl or both) bound to the nitrogen atom.
A. Aniline is a primary amine because it has only one organic substituent (an aryl group) bound to the nitrogen atom.
B. Toluidine is also a primary amine because it has only one organic substituent (an aryl group) bound to the nitrogen atom.
C. Hexamethylene diamine is a diamine, meaning it has two amine groups. However, each of these amine groups is primary, not secondary.
D. Ethylmethyl amine is a secondary amine because it has two organic substituents (an ethyl group and a methyl group) bound to the nitrogen atom.
So, the answer is D. Ethylmethyl amine.
Similar Questions
Which of the following is a secondary amine ?A Aniline B Toluidine C Hexamethylene diamine D Ethylmethyl amine
Which compound is a secondary amine?Group of answer choices(CH3)2NCH2CH3NH2CH2CH3CH3CH2NHCH(CH3)CH2CH3CH3CH(NH2)CH3
Primary amines are identified by __________ reaction
Which of the following amines is the strongest base?Select answer from the options belowTrimethylaminePyrroleAnilinePyridine
an amine each with basic strength greater than and less than N-Methylmethanamine ingaseous state
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.