A secondary amine is a compound where the nitrogen atom is connected to two alkyl or aryl groups and one hydrogen atom.

Looking at the given options:

1. (CH3)2NCH2CH3: This is a tertiary amine because the nitrogen atom is connected to three alkyl groups.

2. NH2CH2CH3: This is a primary amine because the nitrogen atom is connected to one alkyl group and two hydrogen atoms.

3. CH3CH2NHCH(CH3)CH2CH3: This is a secondary amine because the nitrogen atom is connected to two alkyl groups and one hydrogen atom.

4. CH3CH(NH2)CH3: This is a primary amine because the nitrogen atom is connected to one alkyl group and two hydrogen atoms.

So, the compound CH3CH2NHCH(CH3)CH2CH3 is a secondary amine.

Question

A secondary amine is a compound where the nitrogen atom is connected to two alkyl or aryl groups and one hydrogen atom.

Looking at the given options:

1. (CH3)2NCH2CH3: This is a tertiary amine because the nitrogen atom is connected to three alkyl groups.

2. NH2CH2CH3: This is a primary amine because the nitrogen atom is connected to one alkyl group and two hydrogen atoms.

3. CH3CH2NHCH(CH3)CH2CH3: This is a secondary amine because the nitrogen atom is connected to two alkyl groups and one hydrogen atom.

4. CH3CH(NH2)CH3: This is a primary amine because the nitrogen atom is connected to one alkyl group and two hydrogen atoms.

So, the compound CH3CH2NHCH(CH3)CH2CH3 is a secondary amine.

Knowee AI · Accepted Answer

A secondary amine is a compound where the nitrogen atom is connected to two alkyl or aryl groups and one hydrogen atom.

Looking at the given options:

1. (CH3)2NCH2CH3: This is a tertiary amine because the nitrogen atom is connected to three alkyl groups.

2. NH2CH2CH3: This is a primary amine because the nitrogen atom is connected to one alkyl group and two hydrogen atoms.

3. CH3CH2NHCH(CH3)CH2CH3: This is a secondary amine because the nitrogen atom is connected to two alkyl groups and one hydrogen atom.

4. CH3CH(NH2)CH3: This is a primary amine because the nitrogen atom is connected to one alkyl group and two hydrogen atoms.

So, the compound CH3CH2NHCH(CH3)CH2CH3 is a secondary amine.

Which compound is a secondary amine?Group of answer choices(CH3)2NCH2CH3NH2CH2CH3CH3CH2NHCH(CH3)CH2CH3CH3CH(NH2)CH3