What is the product of the unbalanced equation below?H2(g) + Cl2(g) The Periodic TableA.HCl2(g)B.H2(g) + Cl2(g)C.H2Cl2(g)D.HCl(g)
Question
What is the product of the unbalanced equation below?H2(g) + Cl2(g) The Periodic TableA.HCl2(g)B.H2(g) + Cl2(g)C.H2Cl2(g)D.HCl(g)
Solution
The product of the unbalanced equation H2(g) + Cl2(g) is D. HCl(g).
Here's the step-by-step process:
-
Identify the reactants: Hydrogen (H2) and Chlorine (Cl2) are the reactants.
-
Determine the product: When Hydrogen and Chlorine react, they form Hydrogen Chloride (HCl).
-
Balance the equation: The balanced equation is H2(g) + Cl2(g) -> 2HCl(g). This means that one molecule of Hydrogen reacts with one molecule of Chlorine to form two molecules of Hydrogen Chloride.
So, the correct answer is D. HCl(g).
Similar Questions
What is the product of the unbalanced combustion reaction below?C3H8(g) + O2(g) The Periodic TableA.O4H8(s) + C(s)B.C3H8O2(s)C.C(s) + H2(g) + O2(g)D.CO2(g) + H2O(g)
If a reaction occurs, what will be the products of the unbalanced reaction below?Zn(s) + HCl(aq) The Activity Series of ElementsA.ZnH(s) + Cl2(g)B.HZnCl(s)C.ZnCl2(s) + H2(g)D.No reaction will occur.
What is the balanced form of the chemical equation shown below?Cr(s) + Cl2(g) CrCl3(s)A.Cr(s) + Cl2(g) CrCl3(s)B.2Cr(s) + 3Cl2(g) 2CrCl3(s)C.Cr(s) + 3Cl2(g) CrCl3(s)D.Cr(s) + Cl2(g) CrCl2(s)
Jeremy writes the following symbol equation for the reaction in the previous question:K (s) + H2O (l) KOH (aq) + H2 (g)Determine why this equation is unbalanced.There are 2 hydrogens on the reactant side and 1 oxygen on the product sideThere are 2 hydrogens on the reactant side and 3 hydrogens on the product sideThere are 2 hydrogens on the reactant side and only 1 hydrogen on the product sideThere is K on the reactant side and KOH on the product side
What is the balanced form of the chemical equation shown below?C6H12O6(s) + O2(g) H2O(l) + CO2(g)A.C6H12O6(s) + 6O2(g) 6H2O(l) + 6CO2(g)B.C6H12O6(s) + O2(g) 12H2O(l) + 6CO2(g)C.C6H12O6(s) + O2(g) H2O(l) + CO2(g)D.CH2O(s) + O2(g) H2O(l) + CO2(g)
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.