If a reaction occurs, what will be the products of the unbalanced reaction below?Zn(s) + HCl(aq) The Activity Series of ElementsA.ZnH(s) + Cl2(g)B.HZnCl(s)C.ZnCl2(s) + H2(g)D.No reaction will occur.
Question
If a reaction occurs, what will be the products of the unbalanced reaction below?Zn(s) + HCl(aq) The Activity Series of ElementsA.ZnH(s) + Cl2(g)B.HZnCl(s)C.ZnCl2(s) + H2(g)D.No reaction will occur.
Solution
The reaction between Zinc (Zn) and Hydrochloric acid (HCl) is a displacement reaction where Zinc displaces Hydrogen from the Hydrochloric acid. The products of this reaction are Zinc Chloride (ZnCl2) and Hydrogen gas (H2). Therefore, the correct answer is C. ZnCl2(s) + H2(g).
Similar Questions
What is the product of the unbalanced equation below?H2(g) + Cl2(g) The Periodic TableA.HCl2(g)B.H2(g) + Cl2(g)C.H2Cl2(g)D.HCl(g)
If a precipitation reaction occurs, what will be the products of the unbalanced reaction shown below?AgNO3(aq) + NaCl(aq) Solubility TableA.AgCl(s) + NaNO3(aq)B.AgCl(aq) + NaNO3(s)C.AgCl(s) + NaNO3(s)D.No precipitate will form.
What is the product of the unbalanced combustion reaction below?C3H8(g) + O2(g) The Periodic TableA.O4H8(s) + C(s)B.C3H8O2(s)C.C(s) + H2(g) + O2(g)D.CO2(g) + H2O(g)
Balance the following reaction. A coefficient of "1" is understood. Choose option "blank" for the correct answer if the coefficient is "1."Al + ZnCl2 → Zn + AlCl3
what will be the product fromed when zinc reacts with sulphuric acid write the balance chemical equation for this reaction
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.