Knowee
Questions
Features
Study Tools

If a reaction occurs, what will be the products of the unbalanced reaction below?Zn(s) + HCl(aq) The Activity Series of ElementsA.ZnH(s) + Cl2(g)B.HZnCl(s)C.ZnCl2(s) + H2(g)D.No reaction will occur.

Question

If a reaction occurs, what will be the products of the unbalanced reaction below?Zn(s) + HCl(aq) The Activity Series of ElementsA.ZnH(s) + Cl2(g)B.HZnCl(s)C.ZnCl2(s) + H2(g)D.No reaction will occur.

🧐 Not the exact question you are looking for?Go ask a question

Solution

The reaction between Zinc (Zn) and Hydrochloric acid (HCl) is a displacement reaction where Zinc displaces Hydrogen from the Hydrochloric acid. The products of this reaction are Zinc Chloride (ZnCl2) and Hydrogen gas (H2). Therefore, the correct answer is C. ZnCl2(s) + H2(g).

Similar Questions

What is the product of the unbalanced equation below?H2(g) + Cl2(g) The Periodic TableA.HCl2(g)B.H2(g) + Cl2(g)C.H2Cl2(g)D.HCl(g)

If a precipitation reaction occurs, what will be the products of the unbalanced reaction shown below?AgNO3(aq) + NaCl(aq) Solubility TableA.AgCl(s) + NaNO3(aq)B.AgCl(aq) + NaNO3(s)C.AgCl(s) + NaNO3(s)D.No precipitate will form.

What is the product of the unbalanced combustion reaction below?C3H8(g) + O2(g) The Periodic TableA.O4H8(s) + C(s)B.C3H8O2(s)C.C(s) + H2(g) + O2(g)D.CO2(g) + H2O(g)

Balance the following reaction. A coefficient of "1" is understood. Choose option "blank" for the correct answer if the coefficient is "1."Al + ZnCl2 → Zn + AlCl3

what will be the product fromed when zinc reacts with sulphuric acid write the balance chemical equation for this reaction​

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.