Jeremy writes the following symbol equation for the reaction in the previous question:K (s) + H2O (l)  KOH (aq) + H2 (g)Determine why this equation is unbalanced.There are 2 hydrogens on the reactant side and 1 oxygen on the product sideThere are 2 hydrogens on the reactant side and 3 hydrogens on the product sideThere are 2 hydrogens on the reactant side and only 1 hydrogen on the product sideThere is K on the reactant side and KOH on the product side

What is the product of the unbalanced equation below?H2(g) + Cl2(g) The Periodic TableA.HCl2(g)B.H2(g) + Cl2(g)C.H2Cl2(g)D.HCl(g)

What is the product of the unbalanced combustion reaction below?C3H8(g) + O2(g) The Periodic TableA.O4H8(s) + C(s)B.C3H8O2(s)C.C(s) + H2(g) + O2(g)D.CO2(g) + H2O(g)

If a reaction occurs, what will be the products of the unbalanced reaction below?Zn(s) + HCl(aq) The Activity Series of ElementsA.ZnH(s) + Cl2(g)B.HZnCl(s)C.ZnCl2(s) + H2(g)D.No reaction will occur.

Balance the unbalanced equation given and match each substance to the correct coefficient as indicated.Al2S3(s) + H2O(l) → Al(OH)3(aq) + H2S(g)

What is the balanced form of the chemical equation shown below?C6H12O6(s) + O2(g) H2O(l) + CO2(g)A.C6H12O6(s) + 6O2(g) 6H2O(l) + 6CO2(g)B.C6H12O6(s) + O2(g) 12H2O(l) + 6CO2(g)C.C6H12O6(s) + O2(g) H2O(l) + CO2(g)D.CH2O(s) + O2(g) H2O(l) + CO2(g)