Knowee
Questions
Features
Study Tools

Jeremy writes the following symbol equation for the reaction in the previous question:K (s) + H2O (l)  KOH (aq) + H2 (g)Determine why this equation is unbalanced.There are 2 hydrogens on the reactant side and 1 oxygen on the product sideThere are 2 hydrogens on the reactant side and 3 hydrogens on the product sideThere are 2 hydrogens on the reactant side and only 1 hydrogen on the product sideThere is K on the reactant side and KOH on the product side

Question

Jeremy writes the following symbol equation for the reaction in the previous question:K (s) + H2O (l)  KOH (aq) + H2 (g)Determine why this equation is unbalanced.There are 2 hydrogens on the reactant side and 1 oxygen on the product sideThere are 2 hydrogens on the reactant side and 3 hydrogens on the product sideThere are 2 hydrogens on the reactant side and only 1 hydrogen on the product sideThere is K on the reactant side and KOH on the product side

...expand
🧐 Not the exact question you are looking for?Go ask a question

Solution

The equation is unbalanced because there are 2 hydrogens on the reactant side (H2O) and 3 hydrogens on the product side (KOH and H2). In a balanced chemical equation, the number of each type of atom must be the same on both the reactant and product sides.

Similar Questions

What is the product of the unbalanced equation below?H2(g) + Cl2(g) The Periodic TableA.HCl2(g)B.H2(g) + Cl2(g)C.H2Cl2(g)D.HCl(g)

What is the product of the unbalanced combustion reaction below?C3H8(g) + O2(g) The Periodic TableA.O4H8(s) + C(s)B.C3H8O2(s)C.C(s) + H2(g) + O2(g)D.CO2(g) + H2O(g)

If a reaction occurs, what will be the products of the unbalanced reaction below?Zn(s) + HCl(aq) The Activity Series of ElementsA.ZnH(s) + Cl2(g)B.HZnCl(s)C.ZnCl2(s) + H2(g)D.No reaction will occur.

Balance the unbalanced equation given and match each substance to the correct coefficient as indicated.Al2S3(s) + H2O(l) → Al(OH)3(aq) + H2S(g)

What is the balanced form of the chemical equation shown below?C6H12O6(s) + O2(g) H2O(l) + CO2(g)A.C6H12O6(s) + 6O2(g) 6H2O(l) + 6CO2(g)B.C6H12O6(s) + O2(g) 12H2O(l) + 6CO2(g)C.C6H12O6(s) + O2(g) H2O(l) + CO2(g)D.CH2O(s) + O2(g) H2O(l) + CO2(g)

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.