Knowee
Questions
Features
Study Tools

Determine the oxidation state of nitrogen in NH3

Question

Determine the oxidation state of nitrogen in NH3

🧐 Not the exact question you are looking for?Go ask a question

Solution

To determine the oxidation state of nitrogen in NH3, follow these steps:

  1. Understand that the oxidation state is the hypothetical charge that an atom would have if all bonds to atoms of different elements were 100% ionic.

  2. Hydrogen has an oxidation state of +1.

  3. In NH3, there are three Hydrogen atoms, so the total oxidation state contributed by Hydrogen is +3.

  4. The sum of oxidation states for all atoms in a molecule is zero.

  5. Therefore, to balance out the +3 from Hydrogen, Nitrogen must have an oxidation state of -3.

So, the oxidation state of Nitrogen in NH3 is -3.

This problem has been solved

Similar Questions

What is the valency of nitrogen in ammonia (NH3)?

Calculate Oxidation Number of under lined atom in Ammonium Nitrate i.e. NH4NO3

Nitrogen is obtained by the thermal decomposition of:NH4NO2NH4NO3AgNO3Pb(NO3)2

What is the oxidation number of nitrogen in potassium nitrate?Question 1Answera.-3b.+3c.+5d.-1

Using the equilibrium constant expression given below,=KeqNH32N2H23and the equilibrium constant, =Keq0.575, determine the equilibrium concentration of NH3 if the concentration of N2 is ×4.310−2M, and the concentration of H2 is ×6.810−3M. Round your answer to 2 significant figures.

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.