Knowee
Questions
Features
Study Tools

Nitrogen is obtained by the thermal decomposition of:NH4NO2NH4NO3AgNO3Pb(NO3)2

Question

Nitrogen is obtained by the thermal decomposition of:NH4NO2NH4NO3AgNO3Pb(NO3)2

🧐 Not the exact question you are looking for?Go ask a question

Solution

The nitrogen gas can be obtained by the thermal decomposition of ammonium nitrate (NH4NO3). Here is the step by step process:

  1. First, you need to heat the ammonium nitrate. This process is called thermal decomposition, which is a type of chemical reaction where one substance breaks down into two or more substances when heated.

  2. The chemical equation for this reaction is: NH4NO3(s) → N2(g) + 2H2O(g) + O2(g)

  3. When ammonium nitrate is heated, it decomposes into nitrogen gas, water vapor, and oxygen gas.

  4. The nitrogen gas that is produced can then be collected and used for various purposes.

So, the correct answer to your question is NH4NO3 (ammonium nitrate).

This problem has been solved

Similar Questions

Determine the oxidation state of nitrogen in NH3

Extra pure nitrogen can be obtained by heating the following compound

Nitric oxide (NO) can be formed from nitrogen, hydrogen and oxygen in two steps. In the first step, nitrogen and hydrogen react to form ammonia:N2(g) + 3H2(g) → 2NH3(g) =ΔH−92.kJIn the second step, ammonia and oxygen react to form nitric oxide and water:4NH3(g) + 5O2(g) → 4NO(g) + 6H2O(g) =ΔH−905.kJCalculate the net change in enthalpy for the formation of one mole of nitric oxide from nitrogen, hydrogen and oxygen from these reactions.Round your answer to the nearest kJ.

On heating a mixture of NH4Cl and KNO2 we getANH4NO3 BN2 CNO DN2O

Nitrogen is an essential part of the proteins and DNA of organisms. Although nitrogen gas makes up about 78% of Earth’s atmosphere, it is unavailable for use by organisms in its gaseous form. Only when nitrogen is absorbed by beneficial bacteria in the roots of legumes does it enter the pathways that carry it through biological communities.The processes of conversion of atmospheric nitrogen first into ammonium ions (NH4+) and then into nitrates (NO3–) are called respectively*1 pointnitrogen fixation and denitrificationnitrogen fixation and nitrificationammonification and nitrificationammonification and denitrification

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.