Nitric oxide (NO) can be formed from nitrogen, hydrogen and oxygen in two steps. In the first step, nitrogen and hydrogen react to form ammonia:N2(g) + 3H2(g) → 2NH3(g) =ΔH−92.kJIn the second step, ammonia and oxygen react to form nitric oxide and water:4NH3(g) + 5O2(g) → 4NO(g) + 6H2O(g) =ΔH−905.kJCalculate the net change in enthalpy for the formation of one mole of nitric oxide from nitrogen, hydrogen and oxygen from these reactions.Round your answer to the nearest kJ.
Question
Nitric oxide (NO) can be formed from nitrogen, hydrogen and oxygen in two steps. In the first step, nitrogen and hydrogen react to form ammonia:N2(g) + 3H2(g) → 2NH3(g) =ΔH−92.kJIn the second step, ammonia and oxygen react to form nitric oxide and water:4NH3(g) + 5O2(g) → 4NO(g) + 6H2O(g) =ΔH−905.kJCalculate the net change in enthalpy for the formation of one mole of nitric oxide from nitrogen, hydrogen and oxygen from these reactions.Round your answer to the nearest kJ.
Solution
To calculate the net change in enthalpy for the formation of one mole of nitric oxide, we need to consider both reactions.
-
For the first reaction, the enthalpy change (ΔH) is -92 kJ for the formation of 2 moles of ammonia. Therefore, the enthalpy change for the formation of 1 mole of ammonia would be -92 kJ / 2 = -46 kJ.
-
For the second reaction, the enthalpy change (ΔH) is -905 kJ for the formation of 4 moles of nitric oxide. Therefore, the enthalpy change for the formation of 1 mole of nitric oxide would be -905 kJ / 4 = -226.25 kJ.
-
To find the total enthalpy change for the formation of 1 mole of nitric oxide from nitrogen, hydrogen, and oxygen, we need to add the enthalpy changes for the two reactions. This is because the first reaction is necessary to produce the ammonia that is used in the second reaction.
So, the total enthalpy change is -46 kJ (from the first reaction) + -226.25 kJ (from the second reaction) = -272.25 kJ.
Therefore, the net change in enthalpy for the formation of one mole of nitric oxide from nitrogen, hydrogen, and oxygen is approximately -272 kJ (rounded to the nearest kJ).
Similar Questions
The standard enthalpy of formation of gaseous nitrogen dioxide is 33.2 kJ/mol, liquid water is -285.8 kJ/mol, aqueous nitric acid is -207 kJ/mol and the standard enthalpy of formation of gaseous nitrogen monoxide is 91.3 kJ/mol . Calculate the ΔHorxn for the following reaction: 3NO2(g) + H2O(l) → 2 HNO3(aq) + NO(g)
Ammonium nitrate (NH4NO3) can be prepared by reacting ammonia (NH3) withnitric acid (HNO3) in water.i. Write down the balanced chemical equation for the reaction betweenammonia (NH3) and nitric acid (HNO3) in water
How many grams of nitric acid, HNO3, can be prepared from the reaction of 207 g of NO2 with 54.0 g H2O according to the equation below?3NO2 + H2O → 2HNO3 + NOGroup of answer choices12692108189279
Nitrogen is obtained by the thermal decomposition of:NH4NO2NH4NO3AgNO3Pb(NO3)2
Nitrogen gas reacts with oxygen and water to form nitric acid: __N2 + __O2 + __H2O -> __HNO3. What is the mole ratio of oxygen and nitric acid?
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.