Knowee
Questions
Features
Study Tools

What is the IUPAC systematic name for (CH3)2CHOCH2(CH2)3CH3?Select answer from the options below2,2-dimethylhexyl ether1-isopropylpent-1-etherisopropyl pentyl ether1-isopropoxypentane2-methoxy-2-methylheptane

Question

What is the IUPAC systematic name for (CH3)2CHOCH2(CH2)3CH3?Select answer from the options below2,2-dimethylhexyl ether1-isopropylpent-1-etherisopropyl pentyl ether1-isopropoxypentane2-methoxy-2-methylheptane

🧐 Not the exact question you are looking for?Go ask a question

Solution

The IUPAC systematic name for (CH3)2CHOCH2(CH2)3CH3 is 1-isopropoxypentane.

Here's the step-by-step process:

  1. Identify the main chain: The longest carbon chain in the molecule is a pentane (5 carbons), so the base name of the molecule will be a derivative of pentane.

  2. Identify the substituents: The molecule has an isopropyl group (CH3)2CH- attached to the oxygen atom, which is attached to the main chain. This is an ether functional group.

  3. Number the main chain: The carbon of the main chain attached to the oxygen atom is numbered as 1.

  4. Combine the parts: The name is constructed as follows:

    • The location and type of the substituent is indicated by the prefix "1-isopropoxy-".
    • The base name of the molecule is "pentane".

So, the IUPAC systematic name is 1-isopropoxypentane.

This problem has been solved

Similar Questions

What is the common name for (CH3)2CHOCH2(CH2)3CH3?Select answer from the options below1-isopropylpent-1-etherisopropyl pentyl ether2,2-dimethylhexyl ether1-isopropoxidepentane2-methoxy-2-methylheptaneSave for LaterSubmit Answer

The IUPAC name for the compound (CH3)2CHCH2CH(NH2)CH3

The IUPAC name of CH3-CH(C2H5)-CH2-C(C2H5)2-CH3

What is the IUPAC name of CHCCH2CH2CH3a.1-pentyneb.propynec.propened.1-pentene

1. Write IUPAC name of the compound CH3 CH2CH(CH3)CH2CHO.

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.