What is the IUPAC systematic name for (CH3)2CHOCH2(CH2)3CH3?Select answer from the options below2,2-dimethylhexyl ether1-isopropylpent-1-etherisopropyl pentyl ether1-isopropoxypentane2-methoxy-2-methylheptane
Question
What is the IUPAC systematic name for (CH3)2CHOCH2(CH2)3CH3?Select answer from the options below2,2-dimethylhexyl ether1-isopropylpent-1-etherisopropyl pentyl ether1-isopropoxypentane2-methoxy-2-methylheptane
Solution
The IUPAC systematic name for (CH3)2CHOCH2(CH2)3CH3 is 1-isopropoxypentane.
Here's the step-by-step process:
-
Identify the main chain: The longest carbon chain in the molecule is a pentane (5 carbons), so the base name of the molecule will be a derivative of pentane.
-
Identify the substituents: The molecule has an isopropyl group (CH3)2CH- attached to the oxygen atom, which is attached to the main chain. This is an ether functional group.
-
Number the main chain: The carbon of the main chain attached to the oxygen atom is numbered as 1.
-
Combine the parts: The name is constructed as follows:
- The location and type of the substituent is indicated by the prefix "1-isopropoxy-".
- The base name of the molecule is "pentane".
So, the IUPAC systematic name is 1-isopropoxypentane.
Similar Questions
What is the common name for (CH3)2CHOCH2(CH2)3CH3?Select answer from the options below1-isopropylpent-1-etherisopropyl pentyl ether2,2-dimethylhexyl ether1-isopropoxidepentane2-methoxy-2-methylheptaneSave for LaterSubmit Answer
The IUPAC name for the compound (CH3)2CHCH2CH(NH2)CH3
The IUPAC name of CH3-CH(C2H5)-CH2-C(C2H5)2-CH3
What is the IUPAC name of CHCCH2CH2CH3a.1-pentyneb.propynec.propened.1-pentene
1. Write IUPAC name of the compound CH3 CH2CH(CH3)CH2CHO.
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.