Knowee
Questions
Features
Study Tools

1. Write IUPAC name of the compound CH3 CH2CH(CH3)CH2CHO.

Question

  1. Write IUPAC name of the compound CH3 CH2CH(CH3)CH2CHO.
🧐 Not the exact question you are looking for?Go ask a question

Solution

The IUPAC name of the compound CH3 CH2CH(CH3)CH2CHO is 4-Methylpentanal. Here's how we get to that:

  1. Identify the longest carbon chain in the molecule. In this case, it's a chain of 5 carbons.

  2. Identify the functional group. Here, it's an aldehyde group (-CHO), which takes priority in numbering.

  3. Number the carbons in the chain starting from the end closest to the functional group. In this case, the aldehyde group is on the end of the chain, so it's attached to carbon 1.

  4. Identify any substituents. Here, there's a methyl group (-CH3) attached to carbon 4.

  5. Put it all together. The prefix for a 5-carbon chain is "pent-", the suffix for an aldehyde is "-al", and the prefix for a single carbon substituent is "methyl". So the name is 4-Methylpentanal.

This problem has been solved

Similar Questions

The IUPAC name for the compound (CH3)2CHCH2CH(NH2)CH3

The IUPAC name of CH3-CH(C2H5)-CH2-C(C2H5)2-CH3

IUPAC name of (CH3)2 CH – Nh2

What is the IUPAC systematic name for (CH3)2CHOCH2(CH2)3CH3?Select answer from the options below2,2-dimethylhexyl ether1-isopropylpent-1-etherisopropyl pentyl ether1-isopropoxypentane2-methoxy-2-methylheptane

Name the compound, (CH3)3CH

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.