One mole of ________ contains the largest number of atoms.Group of answer choicesS8C10H8Al2(SO4)3Na3PO4Cl2

To answer this question, we need to understand the concept of a mole in chemistry. A mole is a unit of measurement used in chemistry to express amounts of a chemical substance. One mole of any substance contains Avogadro's number (6.022 x 10^23) of particles (atoms, molecules, ions, etc.).

Now, let's break down each substance:

1. S8: This is sulfur. One molecule of S8 contains 8 atoms of sulfur. So, one mole of S8 contains 8 moles of sulfur atoms.

2. C10H8: This is naphthalene. One molecule of C10H8 contains 10 atoms of carbon and 8 atoms of hydrogen. So, one mole of C10H8 contains 10 moles of carbon atoms and 8 moles of hydrogen atoms, a total of 18 moles of atoms.

3. Al2(SO4)3: This is aluminum sulfate. One formula unit of Al2(SO4)3 contains 2 atoms of aluminum, 3 atoms of sulfur, and 12 atoms of oxygen. So, one mole of Al2(SO4)3 contains 2 moles of aluminum atoms, 3 moles of sulfur atoms, and 12 moles of oxygen atoms, a total of 17 moles of atoms.

4. Na3PO4: This is sodium phosphate. One formula unit of Na3PO4 contains 3 atoms of sodium, 1 atom of phosphorus, and 4 atoms of oxygen. So, one mole of Na3PO4 contains 3 moles of sodium atoms, 1 mole of phosphorus atoms, and 4 moles of oxygen atoms, a total of 8 moles of atoms.

5. Cl2: This is chlorine. One molecule of Cl2 contains 2 atoms of chlorine. So, one mole of Cl2 contains 2 moles of chlorine atoms.

From the above analysis, we can see that one mole of C10H8 (naphthalene) contains the largest number of atoms.