Knowee
Questions
Features
Study Tools

Which of the following samples contains the largest number of hydrogen atoms?Group of answer choices4.0 moles of C3H62.0 moles of C6H163.0 moles of C3H86.0 moles of C2H4

Question

Which of the following samples contains the largest number of hydrogen atoms?Group of answer choices4.0 moles of C3H62.0 moles of C6H163.0 moles of C3H86.0 moles of C2H4

🧐 Not the exact question you are looking for?Go ask a question

Solution

To determine which sample contains the largest number of hydrogen atoms, we need to calculate the number of hydrogen atoms in each sample. We can do this by multiplying the number of moles by Avogadro's number (6.022 x 10^23 atoms/mole) and the number of hydrogen atoms in each molecule.

  1. For 4.0 moles of C3H6: Number of hydrogen atoms = 4.0 moles * 6.022 x 10^23 atoms/mole * 6 H/molecule = 1.445 x 10^25 atoms

  2. For 2.0 moles of C6H16: Number of hydrogen atoms = 2.0 moles * 6.022 x 10^23 atoms/mole * 16 H/molecule = 1.927 x 10^25 atoms

  3. For 3.0 moles of C3H8: Number of hydrogen atoms = 3.0 moles * 6.022 x 10^23 atoms/mole * 8 H/molecule = 1.445 x 10^25 atoms

  4. For 6.0 moles of C2H4: Number of hydrogen atoms = 6.0 moles * 6.022 x 10^23 atoms/mole * 4 H/molecule = 1.445 x 10^25 atoms

So, the sample with 2.0 moles of C6H16 contains the largest number of hydrogen atoms.

This problem has been solved

Similar Questions

6. Which of the following gas sample has maximum number of atoms? (A) 44.8 L of O3 at STP (B) 49.2 L of H2 at 1 atm, 300 K (C) 22.4 L of O2 at 2 atm, 546 K (D) 11.2 L of N2O at STP

One mole of ________ contains the largest number of atoms.Group of answer choicesS8C10H8Al2(SO4)3Na3PO4Cl2

There are   × 1024 hydrogen atoms in 2 moles of benzene, C6H6.Give the answer to 3 significant figures (the × 1024 is not required in the answer).

Which one of the following has maximum number of atoms?(a) 18 g of H 2 O(b) 18 g of O 2(c) 18 g of CO 2(d) 18 g of CH

How many H atoms are in 3.4 g of C12H22O11?1. 6.0 × 10232. 1.3 × 10233. 3.8 × 10224. 6.0 × 1021

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.