How many moles of atoms are in one mole of AlPO4? Group of answer choices122.1 moles6.02 X 1023 moles7.35 X 1025 moles6 molesNext
Question
How many moles of atoms are in one mole of AlPO4? Group of answer choices122.1 moles6.02 X 1023 moles7.35 X 1025 moles6 molesNext
Solution
In one molecule of AlPO4, there is 1 atom of Aluminum (Al), 1 atom of Phosphorus (P), and 4 atoms of Oxygen (O). Therefore, in one mole of AlPO4, there are 1 mole of Al atoms, 1 mole of P atoms, and 4 moles of O atoms.
When you add these up, you get a total of 6 moles of atoms.
So, the answer is 6 moles.
Similar Questions
How many moles of atoms are in one mole of AlPO4?
One mole of ________ contains the largest number of atoms.Group of answer choicesS8C10H8Al2(SO4)3Na3PO4Cl2
How many atoms of iron are present in 0.784 moles of iron?Group of answer choices0.784 atoms335 atoms1.30 x 10-24 atoms4.72 x 1023 atoms7.68 x 1023 atoms
8.23 x 1027 molecules of NaCl = ________________________________ moles of NaClRemember that there are 6.02 x 1023 molecules in a mole.Group of answer choices1.37 x 10^4 moles1367 moles1.3652 x 10^-3 moles8.69 moleNext
Ex 3:a) Find the mass of 2.5 moles of NaCl.b) Find the number of molecules in 15 g of hydrochloric acid.c) How many atoms in 6.6 moles of Aluminium oxide.(Careful, there are 5 atoms in one formula unit ofaluminium oxide.)d) How many hydrogen atoms in 7.0 g of water?
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.