Knowee
Questions
Features
Study Tools

Identify incorrect relation : A  [functional group isomers] B CH3–CH2–NH–CH2–CH3 & (CH3)3N[functional group isomers] C  [metamers] D  [functional group isomers]

Question

Identify incorrect relation : A  [functional group isomers] B CH3–CH2–NH–CH2–CH3 & (CH3)3N[functional group isomers] C  [metamers] D  [functional group isomers]

🧐 Not the exact question you are looking for?Go ask a question

Solution

To identify the incorrect relation among the given options, we need to analyze each option and determine if it matches the given category.

Option A states "functional group isomers." Functional group isomers are compounds that have the same molecular formula but differ in the arrangement of functional groups. We need to check if option B, CH3–CH2–NH–CH2–CH3, and (CH3)3N, are functional group isomers.

Option B consists of a primary amine, while option C, (CH3)3N, is a tertiary amine. These two compounds do not have the same functional group arrangement, so they cannot be functional group isomers.

Therefore, the incorrect relation is B [functional group isomers].

This problem has been solved

Similar Questions

Identify incorrect relation : A  [functional group isomers] B CH3–CH2–NH–CH2–CH3 & (CH3)3N[functional group isomers] C  [metamers] D  [functional group isomers]

Which of the following functional groups is matched with its correct name?ANSWERR-NH2: methyl groupR-OH: hydroxyl groupR-CH3: ester groupR-COOH: ether group

Which condensed structure(s) contain an ether functional group?CH3CH2CO2CH2CH3CH3CH2OCH2CH3CH3CH(OH)CH2CHOCH3O(CH2)3CHOA.I onlyB.II onlyC.II and IV onlyD.III and IV only

Which functional group has the general formula NH2?A.AmineB.ThiolC.EsterD.Alcohol

Consider the molecule above. What is the name of the functional group labelled B?Group of answer choices

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.