Which condensed structure(s) contain an ether functional group?CH3CH2CO2CH2CH3CH3CH2OCH2CH3CH3CH(OH)CH2CHOCH3O(CH2)3CHOA.I onlyB.II onlyC.II and IV onlyD.III and IV only

The ether functional group is represented by the structure R-O-R', where R and R' can be any alkyl or aryl group.

Looking at the given structures:

I. CH3CH2CO2CH2CH3 - This structure represents an ester, not an ether. The CO2 part of the structure is characteristic of esters.

II. CH3CH2OCH2CH3 - This structure represents an ether. The O is bonded to two carbon groups (CH3CH2 and CH2CH3), which fits the R-O-R' structure of ethers.

III. CH3CH(OH)CH2CHO - This structure represents a compound with an alcohol group (OH) and an aldehyde group (CHO), not an ether.

IV. CH3O(CH2)3CHO - This structure represents an ether (CH3O part) and an aldehyde (CHO part).

So, the structures that contain an ether functional group are II and IV.

Therefore, the correct answer is C. II and IV only.