Knowee
Questions
Features
Study Tools

IUPAC name of HO−CH2−(CH2)3− CH2−COCH3

Question

IUPAC name of HO−CH2−(CH2)3− CH2−COCH3

🧐 Not the exact question you are looking for?Go ask a question

Solution

The IUPAC name of HO−CH2−(CH2)3− CH2−COCH3 is 6-Hydroxyhexan-2-one.

Here's how we get to that:

  1. Identify the longest carbon chain in the molecule. In this case, it's a chain of 6 carbon atoms.

  2. Identify the functional groups present in the molecule. Here, we have a ketone group (-CO-) and a hydroxyl group (-OH).

  3. The ketone group has a higher priority than the hydroxyl group in the IUPAC nomenclature system. Therefore, the ketone group determines the suffix of the name (in this case, -one for ketone) and the position of the carbon atoms (numbering starts from the end of the chain closest to the ketone group).

  4. The hydroxyl group is considered as a substituent and is indicated by the prefix 'hydroxy-'.

  5. Putting it all together, we have a 6-carbon chain with a ketone group on the 2nd carbon and a hydroxyl group on the 6th carbon. Therefore, the IUPAC name is 6-Hydroxyhexan-2-one.

This problem has been solved

Similar Questions

The IUPAC name for the compound (CH3)2CHCH2CH(NH2)CH3

IUPAC name of (CH3)2 CH – Nh2

The IUPAC name of CH3-CH(C2H5)-CH2-C(C2H5)2-CH3

What is the IUPAC systematic name for (CH3)2CHOCH2(CH2)3CH3?Select answer from the options below2,2-dimethylhexyl ether1-isopropylpent-1-etherisopropyl pentyl ether1-isopropoxypentane2-methoxy-2-methylheptane

What is the IUPAC name of CHCCH2CH2CH3a.1-pentyneb.propynec.propened.1-pentene

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.