Knowee
Questions
Features
Study Tools

Identify incorrect relation : A  [functional group isomers] B CH3–CH2–NH–CH2–CH3 & (CH3)3N[functional group isomers] C

Question

Identify incorrect relation : A  [functional group isomers] B CH3–CH2–NH–CH2–CH3 & (CH3)3N[functional group isomers] C

🧐 Not the exact question you are looking for?Go ask a question

Solution

To identify the incorrect relation among A, B, and C, we need to compare the functional group isomers.

A is mentioned as functional group isomers, but the specific isomers are not provided.

B is given as CH3–CH2–NH–CH2–CH3, which represents a primary amine.

C is mentioned as (CH3)3N, which represents a tertiary amine.

Based on this information, we can conclude that the incorrect relation is between A and C. A does not represent functional group isomers with (CH3)3N.

This problem has been solved

Similar Questions

Identify incorrect relation : A  [functional group isomers] B CH3–CH2–NH–CH2–CH3 & (CH3)3N[functional group isomers] C  [metamers] D  [functional group isomers]

Which of the following functional groups is matched with its correct name?ANSWERR-NH2: methyl groupR-OH: hydroxyl groupR-CH3: ester groupR-COOH: ether group

Which condensed structure(s) contain an ether functional group?CH3CH2CO2CH2CH3CH3CH2OCH2CH3CH3CH(OH)CH2CHOCH3O(CH2)3CHOA.I onlyB.II onlyC.II and IV onlyD.III and IV only

Which functional group has the general formula NH2?A.AmineB.ThiolC.EsterD.Alcohol

Consider the molecule above. What is the name of the functional group labelled B?Group of answer choices

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.