The time complexity of inserting an element at the beginning of a linked list is:Group of answer choicesO(n log n)O(n)O(1)O(log n)
Question
The time complexity of inserting an element at the beginning of a linked list is:Group of answer choicesO(n log n)O(n)O(1)O(log n)
Solution
The time complexity of inserting an element at the beginning of a linked list is O(1).
Here's why:
-
A linked list is a data structure where each element (node) contains a reference (link) to the next node in the sequence.
-
When you insert an element at the beginning of the linked list, you don't need to traverse through the list. You simply create a new node, set its link to the current first node, and then update the list's head to point to the new node.
-
This operation is constant time, meaning it takes the same amount of time regardless of the size of the list. Hence, the time complexity is O(1).
Similar Questions
What is the time complexity of inserting after the nth element of a singly linked list? (Assuming you have a pointer to the node to insert)O(n)O(1)O(log(n))O(nlog(n))O(2^n)O(n!)O(n^2)
What is the time complexity of inserting a node at the beginning of a doubly linked list?O(1)O(log n)O(n)O(n^2)
What is the time complexity of searching for an element in a singly linked list?Group of answer choicesO(n)O(1)O(n log n)O(log n)
What is the time complexity to insert an element to the rear of a LinkedList(head pointer given)?*2 pointsO(n)O(1)O(log(n))None of the above
What would be the time complexity if user tries to insert the element at the end of the linked list (headpointerisknown)?O(1)Your answer has been saved.O(n)O(logn)O(nlogn)
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.