What is the time complexity of searching for an element in a singly linked list?Group of answer choicesO(n)O(1)O(n log n)O(log n)
Question
What is the time complexity of searching for an element in a singly linked list?Group of answer choicesO(n)O(1)O(n log n)O(log n)
Solution
The time complexity of searching for an element in a singly linked list is O(n).
Here's why:
-
A singly linked list is a type of data structure where each element points to the next element in the list.
-
To search for an element, you would have to start at the head of the list and traverse through each element until you find the element you're looking for.
-
In the worst-case scenario, the element you're looking for could be at the end of the list or not in the list at all. In this case, you would have to traverse through all n elements in the list.
-
Therefore, the time complexity of searching for an element in a singly linked list is O(n), where n is the number of elements in the list.
Similar Questions
What is the time complexity of searching for an element in a linked list?O(1)O(log n)O(n)O(n^2)
Which of the following is the time complexity of searching for an element in a circular linked list?OptionsO(1)O(n2)O(nlogn)O(n)
What is the time complexity of inserting a new node at the beginning of a singly linked list?Group of answer choicesO(log n)O(n^2)O(n)O(1)
What is the average time complexity for searching an element in a binary search tree?Group of answer choicesO(log n)O(1)Depends on the tree structureO(n)
In an array-based implementation of a linear list, what is the time complexity of accessing an element at a given index?Group of answer choicesO(n)O(1)O(log n)O(n log n)
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.