Write the condensed formula of the compound 4-methylhept-3-ene.

The condensed formula for the compound 4-methylhept-3-ene is CH3CH2CH2C(CH3)CHCHCH3.

Here's the step-by-step process:

1. "Hept" in the name indicates that there are seven carbon atoms in the longest continuous chain. This is represented by CH3(CH2)5CH3 in a condensed formula.

2. "3-ene" indicates that there is a double bond starting from the third carbon atom in the chain. So, we modify the formula to CH3CH2CH=CH(CH2)3CH3.

3. "4-methyl" indicates that there is a methyl group (CH3) attached to the fourth carbon atom in the chain. So, we modify the formula to CH3CH2CH=C(CH3)(CH2)2CH3.

4. Finally, we simplify the formula to CH3CH2CH2C(CH3)CHCHCH3.

The condensed formula for the compound 4-methylhept-3-ene is CH3CH2CH2C(CH3)CH=CHCH3.

Here's how we get it:

1. "Hept" in the name indicates that there are seven carbon atoms in the longest continuous chain. This is represented by CH3(CH2)5CH3 in the condensed formula.

2. "3-ene" indicates that there is a double bond starting from the third carbon atom in the chain. So, we modify the formula to CH3CH2CH=CH(CH2)3CH3.

3. "4-methyl" indicates that there is a methyl group (CH3) attached to the fourth carbon atom in the chain. So, we further modify the formula to CH3CH2CH=C(CH3)(CH2)2CH3.

4. Finally, we simplify the formula to CH3CH2CH2C(CH3)CH=CHCH3.