The condensed formula for the compound 6-methyl-3-heptene is C8H16. Here's how you get it:

1. "Heptene" indicates a seven-carbon chain with a double bond. The "3" in "3-heptene" tells you that the double bond starts at the third carbon. So, the base structure is CH2=CH-CH2-CH2-CH2-CH2-CH3.

2. "6-methyl" tells you that there's a methyl group (CH3) attached to the sixth carbon in the chain. So, you add that to the structure: CH2=CH-CH2-CH2-CH(CH3)-CH2-CH3.

3. To write the condensed formula, you group the atoms together: C8H16.

Question

The condensed formula for the compound 6-methyl-3-heptene is C8H16. Here's how you get it:

1. "Heptene" indicates a seven-carbon chain with a double bond. The "3" in "3-heptene" tells you that the double bond starts at the third carbon. So, the base structure is CH2=CH-CH2-CH2-CH2-CH2-CH3.

2. "6-methyl" tells you that there's a methyl group (CH3) attached to the sixth carbon in the chain. So, you add that to the structure: CH2=CH-CH2-CH2-CH(CH3)-CH2-CH3.

3. To write the condensed formula, you group the atoms together: C8H16.

Knowee AI · Accepted Answer

The condensed formula for the compound 6-methyl-3-heptene is C8H16. Here's how you get it:

1. "Heptene" indicates a seven-carbon chain with a double bond. The "3" in "3-heptene" tells you that the double bond starts at the third carbon. So, the base structure is CH2=CH-CH2-CH2-CH2-CH2-CH3.

2. "6-methyl" tells you that there's a methyl group (CH3) attached to the sixth carbon in the chain. So, you add that to the structure: CH2=CH-CH2-CH2-CH(CH3)-CH2-CH3.

3. To write the condensed formula, you group the atoms together: C8H16.

Write the condensed formula of the compound 6-methyl-3-heptene.

Question

Solution

Similar Questions

Upgrade your grade with Knowee