How would you name the following compounds?(i) CH3—CH2—Br
Question
How would you name the following compounds?(i) CH3—CH2—Br
Solution
The compound CH3—CH2—Br is named as Bromoethane.
Here's the step by step process:
-
Identify the longest carbon chain. In this case, it's 2 carbons long, which corresponds to "ethane".
-
Identify the functional group. Here, it's a bromine atom, which is a halogen. When a halogen is attached to a carbon chain, we use the prefix "bromo-" for bromine.
-
Identify the position of the functional group. In this case, it's on the second carbon. However, since the chain is only two carbons long, it doesn't matter which end you start counting from. Therefore, we don't need to include a number in the name.
-
Combine the elements from steps 2 and 3 with the base name from step 1. This gives us "Bromoethane".
Similar Questions
Name the compound, (CH3)3CH
Which of the following compounds is named incorrectly?a.HC≡CCH=CH2 but-1-en-3-yneb.CH3CH=CHCH(OH)CH3 3-penten-2-olc.CH3CH(Br)CH3 2-bromopropaned.CH3CH2CH2CH2CH2OH heptanol
Name these organic compounds:structure nameCH3CH2CHCH2CH3CCHCHCH
The IUPAC name of CH3-CH(C2H5)-CH2-C(C2H5)2-CH3
1. Write IUPAC name of the compound CH3 CH2CH(CH3)CH2CHO.
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.