15. Which of the following acids would readily react with CaCO3 to liberate C02?A CH3COOHB H2S04C H2SO3D HNO3PrevNext
Question
- Which of the following acids would readily react with CaCO3 to liberate C02?A CH3COOHB H2S04C H2SO3D HNO3PrevNext
Solution
All of the acids listed (CH3COOH, H2SO4, H2SO3, HNO3) can react with CaCO3 (calcium carbonate) to liberate CO2 (carbon dioxide). This is because they are all acids and can donate a proton (H+) to the carbonate ion (CO3 2-) in the CaCO3, forming H2CO3 (carbonic acid) which then decomposes into H2O (water) and CO2 (carbon dioxide).
The reaction can be summarized as follows:
CaCO3 + 2H+ -> Ca2+ + H2O + CO2
So, the answer is all of the above.
Similar Questions
Which of the following reagents can be used to convert CH3CH2COOH into an acid chloride?Select answer from the options belowSOCl2 acetyl chlorideAlCl3HCl
Which of the following is classified as a carboxylic acid?Select answer from the options below(CH3)3CCO2CH3(CH3)3CCO2HCO2CH3CO2CH2CH3
Which of the following is most acidic :–A HNO3 B H2CO3 C H3BO3 D None of these
Which of the following is a strong acid?Select an answerAHCOOHBHCNCCH3COOHDHClO4
CH3COOH + H2O ' CH3COO- + H3O+
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.