The saponification of a wax differs from the saponification of a fat because a wax will produce _____, while the fat will produce _____.Group of answer choices1 molecule of soap and 1 molecule of glycerol; 3 molecules of soap and 1 molecule of alcohol3 molecules of soap and 1 molecule of glycerol; 1 molecule of soap and 1 molecule of alcohol3 molecules of soap and 1 molecule of alcohol; 1 molecule of soap and 1 molecule of glycerol1 molecule of soap and 1 molecule of alcohol; 3 molecules of soap and 1 molecule of glycerol

What two types of compounds react to form a waxGroup of answer choicesa fatty acid and a high molecular weight alcohola high molecular weight alcohol and a steroida fatty acid and an amidean ester and a fatty acid

Wax is related to Grease in the same way as Milk is related to……?

Saponification is?Group of answer choicesa chemical reaction that explains why soap does not wash off easily in hard water.a chemical reaction that results in an alcohol and a carboxylic acid.a chemical reaction that results in a soap.a chemical reaction due to the presence of a strong organic acid.

What hydrolysis products are formed when the wax CH3(CH2)18COO(CH2)17CH3 is treated with aqueous sulfuric acid? Group of answer choicesCH3(CH2)18COOH + CH3(CH2)16CH2OHCH3(CH2)18CHO + CH3(CH2)16CH2OHCH3(CH2)18COOH + CH3(CH2)16CH3CH3(CH2)18COOH + CH3(CH2)16COOHCH3(CH2)18CH2OH + CH3(CH2)16COOH

A wax is made up of a long-chain fatty acid and a long-chain alcohol joined by:A.an amide linkage.B.an ester linkage.C.an anhydride linkage.D.a glycosidic linkage.