Knowee
Questions
Features
Study Tools

What hydrolysis products are formed when the wax CH3(CH2)18COO(CH2)17CH3 is treated with aqueous sulfuric acid? Group of answer choicesCH3(CH2)18COOH + CH3(CH2)16CH2OHCH3(CH2)18CHO + CH3(CH2)16CH2OHCH3(CH2)18COOH + CH3(CH2)16CH3CH3(CH2)18COOH + CH3(CH2)16COOHCH3(CH2)18CH2OH + CH3(CH2)16COOH

Question

What hydrolysis products are formed when the wax CH3(CH2)18COO(CH2)17CH3 is treated with aqueous sulfuric acid? Group of answer choicesCH3(CH2)18COOH + CH3(CH2)16CH2OHCH3(CH2)18CHO + CH3(CH2)16CH2OHCH3(CH2)18COOH + CH3(CH2)16CH3CH3(CH2)18COOH + CH3(CH2)16COOHCH3(CH2)18CH2OH + CH3(CH2)16COOH

🧐 Not the exact question you are looking for?Go ask a question

Solution

The wax CH3(CH2)18COO(CH2)17CH3 is an ester. When an ester undergoes hydrolysis in the presence of an acid such as sulfuric acid, it breaks down into a carboxylic acid and an alcohol.

The carboxylic acid is formed from the carbonyl part of the ester (CH3(CH2)18COO) and one hydrogen ion from the water. This gives CH3(CH2)18COOH.

The alcohol is formed from the alkyl part of the ester (CH2)17CH3) and the hydroxyl group from the water. This gives CH3(CH2)16CH2OH.

So, the hydrolysis products formed when the wax CH3(CH2)18COO(CH2)17CH3 is treated with aqueous sulfuric acid are CH3(CH2)18COOH and CH3(CH2)16CH2OH.

This problem has been solved

Similar Questions

What two types of compounds react to form a waxGroup of answer choicesa fatty acid and a high molecular weight alcohola high molecular weight alcohol and a steroida fatty acid and an amidean ester and a fatty acid

What are the products of ester hydrolysis using an acid catalyst?Group of answer choicesketone and alchoholaldehyde and alcoholamide and alcoholcarboxylic acid and alcohol

CH2=CH2  + H2O + H+ --> What is the major product of the above reaction?Group of answer choicesCH3-COOHCH3-CH3CH3-CH2-OHCH3-CHO

Question 5(Multiple Choice Worth 3 points)(06.04 LC)Which of the following substances combine with water in the atmosphere to make sulfuric acid? Hydrosulfuric acid Carbon dioxide Sulfur trioxide Sulfur dioxide

What is the product formed when sulfuric acid reacts with calcium carbonate?Group of answer choicesSodium sulfate + carbon dioxideCalcium sulfate + water + carbon dioxideCalcium chloride + hydrogenCarbon dioxide + water

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.