What is the IUPAC name of the potassium salt of m-ethyl benzoic acid?Group of answer choicespotassium 3-ethylbenzoatepotassium 3-ethylbenzoicm-ethyl potassium benzoatepotassium 3-ethylbenzoic acid

The IUPAC name of K3[Co(C2O4)3]K3[Co(C2O4)3] is:

The IUPAC name of CH3-CH(C2H5)-CH2-C(C2H5)2-CH3

Identify the correct IUPAC name of the compound:

Give the IUPAC name of each salt of a carboxylic acid.Part 1 of 2CH3CH2CH2CH2CO−2Na+

What is the IUPAC systematic name for (CH3)2CHOCH2(CH2)3CH3?Select answer from the options below2,2-dimethylhexyl ether1-isopropylpent-1-etherisopropyl pentyl ether1-isopropoxypentane2-methoxy-2-methylheptane