What multiplicities are observed for the signals in the off-resonance decoupled 13C NMR spectrum of 1-chloropropadiene?Select answer from the options belowa singlet, a doublet and a triplet2 singlets and a doublet3 singletsa singlet and 2 doubletsa singlet, a triplet, and a quartet
Question
What multiplicities are observed for the signals in the off-resonance decoupled 13C NMR spectrum of 1-chloropropadiene?Select answer from the options belowa singlet, a doublet and a triplet2 singlets and a doublet3 singletsa singlet and 2 doubletsa singlet, a triplet, and a quartet
Solution
The structure of 1-chloropropadiene is as follows:
H2C=C=CH-Cl
In the 13C NMR spectrum, each carbon atom gives a separate signal. The multiplicity of each signal depends on the number of hydrogen atoms directly attached to the carbon atom.
- The carbon atom at the end of the molecule (attached to the Cl atom) has no hydrogen atoms attached, so its signal is a singlet.
- The carbon atom in the middle of the molecule has one hydrogen atom attached, so its signal is a doublet.
- The carbon atom at the other end of the molecule has two hydrogen atoms attached, so its signal is a triplet.
Therefore, the 13C NMR spectrum of 1-chloropropadiene shows a singlet, a doublet, and a triplet.
Similar Questions
What is the meaning of a triplet in a 13C NMR spectrum which is obtained by a technique called off-resonance decoupling?Select answer from the options belowCH3 (Carbon with three H attached to it) C (with no H attached to it)CH (Carbon with one H attached to it)CH2 (Carbon with two H attached to it)
What is the meaning of a singlet in a 13C NMR spectrum which is obtained by a technique called off-resonance decoupling?Select answer from the options belowCH (Carbon with one H attached to it)CH2 (Carbon with two H attached to it)C (with no H attached to it)CH3 (Carbon with three H attached to it) Save for LaterSubmit Answer
Which of the following compounds exhibits three signals in its 13C NMR spectrum?Select answer from the options below(CH3)2CHCH(CH3)2BrCH2CH2CH2Cl(CH3)2CHOCH(CH3)2BrCH2CH2CH2Br
The 1H NMR spectrum of a compound with the molecular formula C7H15Cl exhibits signals with relative integration 9:3:2:1. Propose a structure for this compound.Select answer from the options below3-chloro-2,4-dimethylpentane3-chloro-2,2-dimethylpentane 4-chloroheptane 2-chloro-2,3,3-trimethylbutane Save for LaterSubmit Answer
Using 1H NMR, what key features would be used to differentiate benzene, hexane and 1,2-dichloroethane?Group of answer choicesHexane would give a singlet at 7-8 ppmBenzene would give multiple signals (triplets, quartets etc.) in the 0-1.5 ppm region1,2-dichloroethane would give a singlet in the 2.5-5 ppm region1,2-dichloroethane would give a singlet at 7-8 ppmBenzene would give multiple signals (triplets, quartets etc.) in the 0-1.5 ppm regionHexane would give a singlet in the 2.5-5 ppm regionBenzene would give a singlet at 7-8 ppmHexane would give multiple signals (triplets, quartets etc.) in the 0-1.5 ppm region1,2-dichloroethane would give a singlet in the 2.5-5 ppm region1,2-dichloroethane would give a singlet at 7-8 ppmHexane would give multiple signals (triplets, quartets etc.) in the 0-1.5 ppm regionBenzene would give a singlet in the 2.5-5 ppm region
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.