Knowee
Questions
Features
Study Tools

What multiplicities are observed for the signals in the off-resonance decoupled 13C NMR spectrum of 1-chloropropadiene?Select answer from the options belowa singlet, a doublet and a triplet2 singlets and a doublet3 singletsa singlet and 2 doubletsa singlet, a triplet, and a quartet

Question

What multiplicities are observed for the signals in the off-resonance decoupled 13C NMR spectrum of 1-chloropropadiene?Select answer from the options belowa singlet, a doublet and a triplet2 singlets and a doublet3 singletsa singlet and 2 doubletsa singlet, a triplet, and a quartet

🧐 Not the exact question you are looking for?Go ask a question

Solution

The structure of 1-chloropropadiene is as follows:

H2C=C=CH-Cl

In the 13C NMR spectrum, each carbon atom gives a separate signal. The multiplicity of each signal depends on the number of hydrogen atoms directly attached to the carbon atom.

  1. The carbon atom at the end of the molecule (attached to the Cl atom) has no hydrogen atoms attached, so its signal is a singlet.
  2. The carbon atom in the middle of the molecule has one hydrogen atom attached, so its signal is a doublet.
  3. The carbon atom at the other end of the molecule has two hydrogen atoms attached, so its signal is a triplet.

Therefore, the 13C NMR spectrum of 1-chloropropadiene shows a singlet, a doublet, and a triplet.

This problem has been solved

Similar Questions

What is the meaning of a triplet in a 13C NMR spectrum which is obtained by a technique called off-resonance decoupling?Select answer from the options belowCH3 (Carbon with three H attached to it)   C (with no H attached to it)CH (Carbon with one H attached to it)CH2 (Carbon with two H attached to it)

What is the meaning of a singlet in a 13C NMR spectrum which is obtained by a technique called off-resonance decoupling?Select answer from the options belowCH (Carbon with one H attached to it)CH2 (Carbon with two H attached to it)C (with no H attached to it)CH3 (Carbon with three H attached to it)   Save for LaterSubmit Answer

Which of the following compounds exhibits three signals in its 13C NMR spectrum?Select answer from the options below(CH3)2CHCH(CH3)2BrCH2CH2CH2Cl(CH3)2CHOCH(CH3)2BrCH2CH2CH2Br

The 1H NMR spectrum of a compound with the molecular formula C7H15Cl exhibits signals with relative integration 9:3:2:1. Propose a structure for this compound.Select answer from the options below3-chloro-2,4-dimethylpentane3-chloro-2,2-dimethylpentane 4-chloroheptane 2-chloro-2,3,3-trimethylbutane Save for LaterSubmit Answer

Using 1H NMR, what key features would be used to differentiate benzene, hexane and 1,2-dichloroethane?Group of answer choicesHexane would give a singlet at 7-8 ppmBenzene would give multiple signals (triplets, quartets etc.) in the 0-1.5 ppm region1,2-dichloroethane would give a singlet in the 2.5-5 ppm region1,2-dichloroethane would give a singlet at 7-8 ppmBenzene would give multiple signals (triplets, quartets etc.) in the 0-1.5 ppm regionHexane would give a singlet in the 2.5-5 ppm regionBenzene would give a singlet at 7-8 ppmHexane would give multiple signals (triplets, quartets etc.) in the 0-1.5 ppm region1,2-dichloroethane would give a singlet in the 2.5-5 ppm region1,2-dichloroethane would give a singlet at 7-8 ppmHexane would give multiple signals (triplets, quartets etc.) in the 0-1.5 ppm regionBenzene would give a singlet in the 2.5-5 ppm region

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.