Knowee
Questions
Features
Study Tools

Maximum number of structural isomers on photochemical monochlorination of 2,3-Dimethyl Pent-2-ene (including allylic rearrangement)

Question

Maximum number of structural isomers on photochemical monochlorination of 2,3-Dimethyl Pent-2-ene (including allylic rearrangement)

🧐 Not the exact question you are looking for?Go ask a question

Solution

The photochemical monochlorination of 2,3-Dimethyl Pent-2-ene involves the addition of a chlorine atom to the molecule. This can occur at different positions, leading to different structural isomers.

Step 1: Identify the molecule 2,3-Dimethyl Pent-2-ene is a hydrocarbon with 7 carbon atoms. The double bond is at the second carbon atom, and there are methyl groups attached to the second and third carbon atoms.

Step 2: Identify the possible positions for chlorination The chlorine atom can be added to any of the hydrogen atoms in the molecule. There are 3 unique positions for the chlorine atom:

  • The carbon atoms at the ends of the molecule (1st and 7th positions)
  • The carbon atoms with the methyl groups (2nd and 3rd positions)
  • The carbon atoms in the middle of the molecule (4th, 5th, and 6th positions)

Step 3: Count the number of possible isomers Adding the chlorine atom to the 1st or 7th position will give the same isomer, so there are 2 possible isomers from these positions. Adding the chlorine atom to the 2nd or 3rd position will give 2 unique isomers (one for each position), so there are 2 possible isomers from these positions. Adding the chlorine atom to the 4th, 5th, or 6th position will give the same isomer, so there are 3 possible isomers from these positions.

Step 4: Consider the allylic rearrangement The allylic rearrangement can occur when the chlorine atom is added to the 2nd or 3rd position. This can lead to 2 additional isomers.

So, the maximum number of structural isomers on photochemical monochlorination of 2,3-Dimethyl Pent-2-ene (including allylic rearrangement) is 2 (from the 1st and 7th positions) + 2 (from the 2nd and 3rd positions) + 3 (from the 4th, 5th, and 6th positions) + 2 (from the allylic rearrangement) = 9 isomers.

This problem has been solved

Similar Questions

The maximum number of possible isomers (including stereoisomers) which may be formed on allylic mono-bromination of 1-methylcyclohex-1-ene using Br2 and UV light is ____

The following structures are two cis/trans of pent-2-ene. Which is the cis isomer?Group of answer choicesNone of the options1 and 221

The structure of 4-Methylpent-2-en-1-ol is: (a) CH3CH2CH=CHCH2OH(b)(CH3)2C=CHCH2CH2OH (c)(CH3)2CHCH=CHCH2OH(d)CH3CH(OH)CH-CH=C(CH3)2.

pent-1-yne and 3-methyl but-1-yne are _ isomers

A position isomer of 2-pentanone is :A 3-Pentanone B 3-Methyl-2-butanone C 1-Pentanal D 2,2-Dimethylpropanal

1/1

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.