Draw the structures of all the eight structural isomers that have themolecular formula C5H11Br. Name each isomer according to IUPAC systemand classify them as primary, secondary or tertiary bromide
Question
Draw the structures of all the eight structural isomers that have themolecular formula C5H11Br. Name each isomer according to IUPAC systemand classify them as primary, secondary or tertiary bromide
Solution
Sure, here are the eight structural isomers of C5H11Br:
-
1-Bromopentane (Primary Bromide) Structure: CH3-CH2-CH2-CH2-CH2-Br
-
2-Bromopentane (Secondary Bromide) Structure: CH3-CH2-CH2-CH(Br)-CH3
-
3-Bromopentane (Secondary Bromide) Structure: CH3-CH2-CH(Br)-CH2-CH3
-
1-Bromo-2-methylbutane (Primary Bromide) Structure: CH3-CH(Br)-CH2-CH(CH3)-CH3
-
2-Bromo-2-methylbutane (Tertiary Bromide) Structure: CH3-C(Br)(CH3)-CH2-CH3
-
1-Bromo-3-methylbutane (Primary Bromide) Structure: CH3-CH2-CH(Br)-CH(CH3)-CH3
-
2-Bromo-3-methylbutane (Secondary Bromide) Structure: CH3-CH(Br)-CH(CH3)-CH2-CH3
-
1-Bromo-2,2-dimethylpropane (Primary Bromide) Structure: CH3-C(Br)(CH3)-C(CH3)2
Please note that the structures are written in a simplified form. In a more detailed structure, each carbon (C) is bonded to the necessary number of hydrogen (H) atoms to make a total of four bonds per carbon. The bromine (Br) atom is also bonded to the carbon. The classification of primary, secondary, or tertiary refers to the carbon atom that the bromine is attached to. If it's attached to a carbon that's only attached to one other carbon, it's primary. If it's attached to a carbon that's attached to two other carbons, it's secondary. If it's attached to a carbon that's attached to three other carbons, it's tertiary.
Similar Questions
What is the number of structural isomers that can exist for the formula C4H10O? A) 4 B) 5 C) 6 D) 7 E) 8
The total number of structural isomers of molecular formula C6H14 is :A 4 B 5 C 6 D 7
What is the total number of structural isomers of molecular formula C4H9Br.A 3 B 5 C 4 D 6
Draw the structures for the following compounds.(i) Ethanoic acid (ii) Bromopentane*(iii) Butanone (iv) Hexanal.
Which of the molecules below shows geometric isomerism? A) C5H10 B) C3H6 C) C4H6 D) C4H10O E) C4H10
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.