Give the name of the functional group of carboxylic acids.

Select the functional group for carboxylic acids from the following list.

Which functional group is characteristic of carboxylic acids?a. -OHb. -CHOc. -COOHd. -NH2

The compound with three carbon atoms whose functional group is a carboxyl.

Which of the following is classified as a carboxylic acid?Select answer from the options below(CH3)3CCO2CH3(CH3)3CCO2HCO2CH3CO2CH2CH3

Which functional group consists of a hydrocarbon with an -OH group?Group of answer choicesAlcoholsCarboxylic AcidsEstersKetones