What is the IUPAC name of this structure :p-OHC–C6H4–CHOA Benzene-1,4-dial B Benzene 1,4-dicarbaldehyde C Octane-1,8 dial D Phthaldehyde

What is the IUPAC name of this compound?Multiple Choice5-ethyl-4-methyl-4-heptene3-ethyl-4-methyl-3-hexene3-ethyl-4-methyl-4-heptene3-ethyl-4-methyl-3-heptene3-ethyl-4-propyl-2-pentene

Give the IUPAC name of the following structure:CHClCHCH3CH2CH3CH2CH2CHCHCH3

Identify the correct IUPAC name of the compound:

The IUPAC name of CH3-CH(C2H5)-CH2-C(C2H5)2-CH3

IUPAC name of the compounds is :-2-nitro-4-bromobenzoic acid4-bromo-3-nitrobenzoic acid4-bromo-2-nitrobenzoic acid4-bromo-3-nitrobenzenecarboxylic acid