iupac name of ethylacetylene
Solution
The IUPAC name of ethylacetylene is But-1-yne.
Here's the step-by-step process:
-
Identify the longest carbon chain that contains the triple bond. In this case, it's a 4-carbon chain.
-
Number the carbon atoms in the chain starting from the end nearest the triple bond. In this case, the triple bond starts at the first carbon.
-
The suffix "-yne" is used to denote the presence of a triple bond.
-
Therefore, the IUPAC name is But-1-yne. The "But" indicates a 4-carbon chain, the "1" indicates the position of the triple bond, and the "-yne" indicates the presence of a triple bond.
Similar Questions
The IUPAC name of dimethyl acetylene is
Identify the correct IUPAC name of the compound:
What is the IUPAC name of this compound?Multiple Choice5-ethyl-4-methyl-4-heptene3-ethyl-4-methyl-3-hexene3-ethyl-4-methyl-4-heptene3-ethyl-4-methyl-3-heptene3-ethyl-4-propyl-2-pentene
The IUPAC name of CH3-CH(C2H5)-CH2-C(C2H5)2-CH3
What is the IUPAC systematic name for (CH3)2CHOCH2(CH2)3CH3?Select answer from the options below1-isopropylpent-1-etherisopropyl pentyl ether2,2-dimethylhexyl ether1-isopropoxypentane2-methoxy-2-methylheptane
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.