Knowee
Questions
Features
Study Tools

iupac name of ethylacetylene

Question

iupac name of ethylacetylene

🧐 Not the exact question you are looking for?Go ask a question

Solution

The IUPAC name of ethylacetylene is But-1-yne.

Here's the step-by-step process:

  1. Identify the longest carbon chain that contains the triple bond. In this case, it's a 4-carbon chain.

  2. Number the carbon atoms in the chain starting from the end nearest the triple bond. In this case, the triple bond starts at the first carbon.

  3. The suffix "-yne" is used to denote the presence of a triple bond.

  4. Therefore, the IUPAC name is But-1-yne. The "But" indicates a 4-carbon chain, the "1" indicates the position of the triple bond, and the "-yne" indicates the presence of a triple bond.

This problem has been solved

Similar Questions

The IUPAC name of dimethyl acetylene  is

Identify the correct IUPAC name of the compound:

What is the IUPAC name of this compound?Multiple Choice5-ethyl-4-methyl-4-heptene3-ethyl-4-methyl-3-hexene3-ethyl-4-methyl-4-heptene3-ethyl-4-methyl-3-heptene3-ethyl-4-propyl-2-pentene

The IUPAC name of CH3-CH(C2H5)-CH2-C(C2H5)2-CH3

What is the IUPAC systematic name for (CH3)2CHOCH2(CH2)3CH3?Select answer from the options below1-isopropylpent-1-etherisopropyl pentyl ether2,2-dimethylhexyl ether1-isopropoxypentane2-methoxy-2-methylheptane

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.