structures corresponds to (Z)-3-methoxy-4-methylhex-3-ene
Question
structures corresponds to (Z)-3-methoxy-4-methylhex-3-ene
Solution
The structure of (Z)-3-methoxy-4-methylhex-3-ene can be determined by following these steps:
-
Identify the longest carbon chain in the molecule. In this case, it's a hexene, which means a six-carbon chain with a double bond.
-
The "3-ene" in the name indicates that the double bond starts at the third carbon atom in the chain.
-
The "4-methyl" indicates that there is a methyl group (CH3) attached to the fourth carbon atom in the chain.
-
The "3-methoxy" indicates that there is a methoxy group (OCH3) attached to the third carbon atom in the chain.
-
The (Z) configuration indicates that the highest-priority groups on each carbon atom of the double bond are on the same side of the molecule. In this case, the methoxy group and the part of the chain containing the methyl group are the highest-priority groups.
So, the structure corresponds to a six-carbon chain with a double bond between the third and fourth carbon atoms. The third carbon atom is bonded to a methoxy group and the fourth carbon atom is bonded to a methyl group. The methoxy and methyl groups are on the same side of the molecule.
Similar Questions
please draw all the three structures below. Thanks!1. 2-methyl-3-vinyl-1,4-pentadiene2. 1-allyl-3,3-dimethyl-2-vinylcyclohexene3. (2E,6E,10Z)-3,7-dimethyl-2,6,10-dodecatrien-1-ol
What is the structure of N-ethyl-N-methyl Ethanamine ?A CH3NHCH(CH3)2 B (CH3)2NCH2CH3 C (CH3CH2)2NCH3 D (CH3)3CNH2
The structure of 4-Methylpent-2-en-1-ol is: (a) CH3CH2CH=CHCH2OH(b)(CH3)2C=CHCH2CH2OH (c)(CH3)2CHCH=CHCH2OH(d)CH3CH(OH)CH-CH=C(CH3)2.
Which one of the following structures corresponds to 4-phenoxyheptane?Select answer from the options belowCH3CH2CH(OCH2Ph)CH2CH2CH3CH3(CH2)3CH(OPh)CH2CH3CH3CH2CH2CH(OCH2Ph)CH2CH2CH3CH3CH2CH2CH(OPh)CH2CH2CH3CH3CH2CH(OPh)CH2CH2CH3
Draw skeletal structures (line diagrams) of each of the following organiccompounds• cyclopentane• 1,2-dimethylbenzene• 3-ethyl-4-chloro-hexan-1-ol• (Z)-but-2-ene
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.